C16H22N2O3 — CID 140786987
tert-butyl (1S,3R,4S)-3-(4-aminophenyl)-2-oxa-5-azabicyclo[2.2.1]heptane-5-carboxylate (PubChem CID 140786987) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is tert-butyl (1S,3R,4S)-3-(4-aminophenyl)-2-oxa-5-azabicyclo[2.2.1]heptane-5-carboxylate.
| Compound Name | tert-butyl (1S,3R,4S)-3-(4-aminophenyl)-2-oxa-5-azabicyclo[2.2.1]heptane-5-carboxylate |
|---|---|
| PubChem CID | 140786987 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | tert-butyl (1S,3R,4S)-3-(4-aminophenyl)-2-oxa-5-azabicyclo[2.2.1]heptane-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]2C[C@H]1[C@@H](c1ccc(N)cc1)O2 |
| InChI | InChI=1S/C16H22N2O3/c1-16(2,3)21-15(19)18-9-12-8-13(18)14(20-12)10-4-6-11(17)7-5-10/h4-7,12-14H,8-9,17H2,1-3H3/t12-,13-,14+/m0/s1 |
| InChIKey | RPMYZEMAXYCREY-MELADBBJSA-N |
| XLogP | 2.72 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|