C16H18F3N3O3 — CID 146591531
4-[(4-methylpiperidin-1-yl)methyl]-2-oxido-3-[3-(trifluoromethoxy)phenyl]-1,2,5-oxadiazol-2-ium (PubChem CID 146591531) has the molecular formula C16H18F3N3O3 and a molecular weight of 357.33 g/mol. Its IUPAC name is 4-[(4-methylpiperidin-1-yl)methyl]-2-oxido-3-[3-(trifluoromethoxy)phenyl]-1,2,5-oxadiazol-2-ium.
| Compound Name | 4-[(4-methylpiperidin-1-yl)methyl]-2-oxido-3-[3-(trifluoromethoxy)phenyl]-1,2,5-oxadiazol-2-ium |
|---|---|
| PubChem CID | 146591531 |
| Molecular Formula | C16H18F3N3O3 |
| Molecular Weight | 357.33 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | 4-[(4-methylpiperidin-1-yl)methyl]-2-oxido-3-[3-(trifluoromethoxy)phenyl]-1,2,5-oxadiazol-2-ium |
| SMILES | CC1CCN(Cc2no[n+]([O-])c2-c2cccc(OC(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C16H18F3N3O3/c1-11-5-7-21(8-6-11)10-14-15(22(23)25-20-14)12-3-2-4-13(9-12)24-16(17,18)19/h2-4,9,11H,5-8,10H2,1H3 |
| InChIKey | DKZXLAGZVPUHSM-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 65.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.33 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|