C17H18F3N3O4 — CID 146591544
(3aR,7aS)-5-[[5-oxido-4-[3-(trifluoromethoxy)phenyl]-1,2,5-oxadiazol-5-ium-3-yl]methyl]-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridine (PubChem CID 146591544) has the molecular formula C17H18F3N3O4 and a molecular weight of 385.34 g/mol. Its IUPAC name is (3aR,7aS)-5-[[5-oxido-4-[3-(trifluoromethoxy)phenyl]-1,2,5-oxadiazol-5-ium-3-yl]methyl]-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridine.
| Compound Name | (3aR,7aS)-5-[[5-oxido-4-[3-(trifluoromethoxy)phenyl]-1,2,5-oxadiazol-5-ium-3-yl]methyl]-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridine |
|---|---|
| PubChem CID | 146591544 |
| Molecular Formula | C17H18F3N3O4 |
| Molecular Weight | 385.34 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | (3aR,7aS)-5-[[5-oxido-4-[3-(trifluoromethoxy)phenyl]-1,2,5-oxadiazol-5-ium-3-yl]methyl]-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridine |
| SMILES | [O-][n+]1onc(CN2CC[C@@H]3OCC[C@@H]3C2)c1-c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C17H18F3N3O4/c18-17(19,20)26-13-3-1-2-11(8-13)16-14(21-27-23(16)24)10-22-6-4-15-12(9-22)5-7-25-15/h1-3,8,12,15H,4-7,9-10H2/t12-,15+/m1/s1 |
| InChIKey | QHXQNLTYJFDEEK-DOMZBBRYSA-N |
| XLogP | 2.48 |
| TPSA | 74.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.34 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|