About N-(2,3-dihydropyridin-6-ylmethyl)-N-methylpropan-1-amine
N-(2,3-dihydropyridin-6-ylmethyl)-N-methylpropan-1-amine (PubChem CID 146592609) has the molecular formula C10H18N2
and a molecular weight of 166.27 g/mol. Its IUPAC name is N-(2,3-dihydropyridin-6-ylmethyl)-N-methylpropan-1-amine.
Molecular Properties
| Compound Name | N-(2,3-dihydropyridin-6-ylmethyl)-N-methylpropan-1-amine |
| PubChem CID | 146592609 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | N-(2,3-dihydropyridin-6-ylmethyl)-N-methylpropan-1-amine |
| SMILES | CCCN(C)CC1=NCCC=C1 |
| InChI | InChI=1S/C10H18N2/c1-3-8-12(2)9-10-6-4-5-7-11-10/h4,6H,3,5,7-9H2,1-2H3 |
| InChIKey | KNLNYHPWRMQSQG-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(2,3-dihydropyridin-6-ylmethyl)-N-methylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,3-dihydropyridin-6-ylmethyl)-N-methylpropan-1-amine?
The IUPAC name of N-(2,3-dihydropyridin-6-ylmethyl)-N-methylpropan-1-amine (CID 146592609) is N-(2,3-dihydropyridin-6-ylmethyl)-N-methylpropan-1-amine.
What is the SMILES notation for N-(2,3-dihydropyridin-6-ylmethyl)-N-methylpropan-1-amine?
The canonical SMILES for N-(2,3-dihydropyridin-6-ylmethyl)-N-methylpropan-1-amine is CCCN(C)CC1=NCCC=C1.
What is the InChIKey of N-(2,3-dihydropyridin-6-ylmethyl)-N-methylpropan-1-amine?
The InChIKey is KNLNYHPWRMQSQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2/c1-3-8-12(2)9-10-6-4-5-7-11-10/h4,6H,3,5,7-9H2,1-2H3.
What are the key properties of N-(2,3-dihydropyridin-6-ylmethyl)-N-methylpropan-1-amine?
N-(2,3-dihydropyridin-6-ylmethyl)-N-methylpropan-1-amine has a molecular weight of 166.27 g/mol, XLogP of 1.73, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,3-dihydropyridin-6-ylmethyl)-N-methylpropan-1-amine is sourced from PubChem (CID 146592609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).