C10H18N4O3 — CID 146592865
tert-butyl 6-amino-6-(aminomethyl)-2-oxo-1H-pyrimidine-3-carboxylate (PubChem CID 146592865) has the molecular formula C10H18N4O3 and a molecular weight of 242.28 g/mol. Its IUPAC name is tert-butyl 6-amino-6-(aminomethyl)-2-oxo-1H-pyrimidine-3-carboxylate.
| Compound Name | tert-butyl 6-amino-6-(aminomethyl)-2-oxo-1H-pyrimidine-3-carboxylate |
|---|---|
| PubChem CID | 146592865 |
| Molecular Formula | C10H18N4O3 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | tert-butyl 6-amino-6-(aminomethyl)-2-oxo-1H-pyrimidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C=CC(N)(CN)NC1=O |
| InChI | InChI=1S/C10H18N4O3/c1-9(2,3)17-8(16)14-5-4-10(12,6-11)13-7(14)15/h4-5H,6,11-12H2,1-3H3,(H,13,15) |
| InChIKey | ATDCJLZSRZPCII-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 110.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |