C14H18N4O3 — CID 146592883
tert-butyl 6-amino-2-oxo-6-pyridin-3-yl-1H-pyrimidine-3-carboxylate (PubChem CID 146592883) has the molecular formula C14H18N4O3 and a molecular weight of 290.32 g/mol. Its IUPAC name is tert-butyl 6-amino-2-oxo-6-pyridin-3-yl-1H-pyrimidine-3-carboxylate.
| Compound Name | tert-butyl 6-amino-2-oxo-6-pyridin-3-yl-1H-pyrimidine-3-carboxylate |
|---|---|
| PubChem CID | 146592883 |
| Molecular Formula | C14H18N4O3 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | tert-butyl 6-amino-2-oxo-6-pyridin-3-yl-1H-pyrimidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C=CC(N)(c2cccnc2)NC1=O |
| InChI | InChI=1S/C14H18N4O3/c1-13(2,3)21-12(20)18-8-6-14(15,17-11(18)19)10-5-4-7-16-9-10/h4-9H,15H2,1-3H3,(H,17,19) |
| InChIKey | VWCPPINVEGFWJR-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |