C16H20N2O3 — CID 58629663
tert-butyl 3-oxo-4-pyridin-3-yl-2-azabicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 58629663) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is tert-butyl 3-oxo-4-pyridin-3-yl-2-azabicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | tert-butyl 3-oxo-4-pyridin-3-yl-2-azabicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 58629663 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | tert-butyl 3-oxo-4-pyridin-3-yl-2-azabicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)C2(c3cccnc3)CCC1C2 |
| InChI | InChI=1S/C16H20N2O3/c1-15(2,3)21-14(20)18-12-6-7-16(9-12,13(18)19)11-5-4-8-17-10-11/h4-5,8,10,12H,6-7,9H2,1-3H3 |
| InChIKey | CFXSKKNVMATRFA-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |