C28H31F2NO6S — CID 146593335
methyl 3-[(2R,4R)-2-[2,5-difluoro-4-[[(3S,6R)-3-methyl-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]phenyl]-4-hydroxy-2-bicyclo[2.1.0]pentanyl]-2-methyl-3-oxopropanoate (PubChem CID 146593335) has the molecular formula C28H31F2NO6S and a molecular weight of 547.62 g/mol. Its IUPAC name is methyl 3-[(2R,4R)-2-[2,5-difluoro-4-[[(3S,6R)-3-methyl-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]phenyl]-4-hydroxy-2-bicyclo[2.1.0]pentanyl]-2-methyl-3-oxopropanoate.
| Compound Name | methyl 3-[(2R,4R)-2-[2,5-difluoro-4-[[(3S,6R)-3-methyl-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]phenyl]-4-hydroxy-2-bicyclo[2.1.0]pentanyl]-2-methyl-3-oxopropanoate |
|---|---|
| PubChem CID | 146593335 |
| Molecular Formula | C28H31F2NO6S |
| Molecular Weight | 547.62 g/mol |
| Exact Mass | 547.18 |
| IUPAC Name | methyl 3-[(2R,4R)-2-[2,5-difluoro-4-[[(3S,6R)-3-methyl-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]phenyl]-4-hydroxy-2-bicyclo[2.1.0]pentanyl]-2-methyl-3-oxopropanoate |
| SMILES | COC(=O)C(C)C(=O)[C@]1(c2cc(F)c(CN3[C@@H](C)CC[C@H](c4ccccc4)S3(=O)=O)cc2F)C[C@]2(O)CC21 |
| InChI | InChI=1S/C28H31F2NO6S/c1-16-9-10-23(18-7-5-4-6-8-18)38(35,36)31(16)14-19-11-22(30)20(12-21(19)29)28(15-27(34)13-24(27)28)25(32)17(2)26(33)37-3/h4-8,11-12,16-17,23-24,34H,9-10,13-15H2,1-3H3/t16-,17?,23+,24?,27+,28-/m0/s1 |
| InChIKey | NJEIAGGJXBNQKK-VUITZXLDSA-N |
| XLogP | 3.79 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.62 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|