C31H43F2NO6SSi — CID 140862979
methyl 1-[2,5-difluoro-4-[[(3S,6R)-3-methyl-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]phenyl]-3-methyl-3-(2-trimethylsilylethoxymethoxy)cyclobutane-1-carboxylate (PubChem CID 140862979) has the molecular formula C31H43F2NO6SSi and a molecular weight of 623.84 g/mol. Its IUPAC name is methyl 1-[2,5-difluoro-4-[[(3S,6R)-3-methyl-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]phenyl]-3-methyl-3-(2-trimethylsilylethoxymethoxy)cyclobutane-1-carboxylate.
| Compound Name | methyl 1-[2,5-difluoro-4-[[(3S,6R)-3-methyl-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]phenyl]-3-methyl-3-(2-trimethylsilylethoxymethoxy)cyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 140862979 |
| Molecular Formula | C31H43F2NO6SSi |
| Molecular Weight | 623.84 g/mol |
| Exact Mass | 623.25 |
| IUPAC Name | methyl 1-[2,5-difluoro-4-[[(3S,6R)-3-methyl-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]phenyl]-3-methyl-3-(2-trimethylsilylethoxymethoxy)cyclobutane-1-carboxylate |
| SMILES | COC(=O)C1(c2cc(F)c(CN3[C@@H](C)CC[C@H](c4ccccc4)S3(=O)=O)cc2F)CC(C)(OCOCC[Si](C)(C)C)C1 |
| InChI | InChI=1S/C31H43F2NO6SSi/c1-22-12-13-28(23-10-8-7-9-11-23)41(36,37)34(22)18-24-16-27(33)25(17-26(24)32)31(29(35)38-3)19-30(2,20-31)40-21-39-14-15-42(4,5)6/h7-11,16-17,22,28H,12-15,18-21H2,1-6H3/t22-,28+,30?,31?/m0/s1 |
| InChIKey | OAQHPDKKHIMOOR-NZFLADSASA-N |
| XLogP | 6.31 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.84 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|