C30H41F2NO5SSi — CID 145227088
(1S)-1-[2,5-difluoro-4-[[(3S,6R)-3-methyl-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]phenyl]-3-(2-trimethylsilylethoxymethoxy)cyclopentane-1-carbaldehyde (PubChem CID 145227088) has the molecular formula C30H41F2NO5SSi and a molecular weight of 593.81 g/mol. Its IUPAC name is (1S)-1-[2,5-difluoro-4-[[(3S,6R)-3-methyl-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]phenyl]-3-(2-trimethylsilylethoxymethoxy)cyclopentane-1-carbaldehyde.
| Compound Name | (1S)-1-[2,5-difluoro-4-[[(3S,6R)-3-methyl-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]phenyl]-3-(2-trimethylsilylethoxymethoxy)cyclopentane-1-carbaldehyde |
|---|---|
| PubChem CID | 145227088 |
| Molecular Formula | C30H41F2NO5SSi |
| Molecular Weight | 593.81 g/mol |
| Exact Mass | 593.24 |
| IUPAC Name | (1S)-1-[2,5-difluoro-4-[[(3S,6R)-3-methyl-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]phenyl]-3-(2-trimethylsilylethoxymethoxy)cyclopentane-1-carbaldehyde |
| SMILES | C[C@H]1CC[C@H](c2ccccc2)S(=O)(=O)N1Cc1cc(F)c([C@]2(C=O)CCC(OCOCC[Si](C)(C)C)C2)cc1F |
| InChI | InChI=1S/C30H41F2NO5SSi/c1-22-10-11-29(23-8-6-5-7-9-23)39(35,36)33(22)19-24-16-28(32)26(17-27(24)31)30(20-34)13-12-25(18-30)38-21-37-14-15-40(2,3)4/h5-9,16-17,20,22,25,29H,10-15,18-19,21H2,1-4H3/t22-,25?,29+,30+/m0/s1 |
| InChIKey | YNEIYXZQLDQPJX-GJACBVOFSA-N |
| XLogP | 6.34 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.81 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|