C25H27F2N3O4S — CID 134438821
5-[1-[2,5-difluoro-4-[[(3S,6R)-3-methyl-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]phenyl]-3-methylcyclobutyl]-3H-1,3,4-oxadiazol-2-one (PubChem CID 134438821) has the molecular formula C25H27F2N3O4S and a molecular weight of 503.57 g/mol. Its IUPAC name is 5-[1-[2,5-difluoro-4-[[(3S,6R)-3-methyl-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]phenyl]-3-methylcyclobutyl]-3H-1,3,4-oxadiazol-2-one.
| Compound Name | 5-[1-[2,5-difluoro-4-[[(3S,6R)-3-methyl-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]phenyl]-3-methylcyclobutyl]-3H-1,3,4-oxadiazol-2-one |
|---|---|
| PubChem CID | 134438821 |
| Molecular Formula | C25H27F2N3O4S |
| Molecular Weight | 503.57 g/mol |
| Exact Mass | 503.17 |
| IUPAC Name | 5-[1-[2,5-difluoro-4-[[(3S,6R)-3-methyl-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]phenyl]-3-methylcyclobutyl]-3H-1,3,4-oxadiazol-2-one |
| SMILES | CC1CC(c2n[nH]c(=O)o2)(c2cc(F)c(CN3[C@@H](C)CC[C@H](c4ccccc4)S3(=O)=O)cc2F)C1 |
| InChI | InChI=1S/C25H27F2N3O4S/c1-15-12-25(13-15,23-28-29-24(31)34-23)19-11-20(26)18(10-21(19)27)14-30-16(2)8-9-22(35(30,32)33)17-6-4-3-5-7-17/h3-7,10-11,15-16,22H,8-9,12-14H2,1-2H3,(H,29,31)/t15?,16-,22+,25?/m0/s1 |
| InChIKey | PSSGZSGCHHRBFW-OFEVBENQSA-N |
| XLogP | 4.41 |
| TPSA | 96.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.57 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |