C23H25F2N3O5S — CID 121414899
5-[(S)-[2,5-difluoro-4-[[(3S,6R)-3-methyl-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]phenyl]-ethoxymethyl]-3H-1,3,4-oxadiazol-2-one (PubChem CID 121414899) has the molecular formula C23H25F2N3O5S and a molecular weight of 493.53 g/mol. Its IUPAC name is 5-[(S)-[2,5-difluoro-4-[[(3S,6R)-3-methyl-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]phenyl]-ethoxymethyl]-3H-1,3,4-oxadiazol-2-one.
| Compound Name | 5-[(S)-[2,5-difluoro-4-[[(3S,6R)-3-methyl-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]phenyl]-ethoxymethyl]-3H-1,3,4-oxadiazol-2-one |
|---|---|
| PubChem CID | 121414899 |
| Molecular Formula | C23H25F2N3O5S |
| Molecular Weight | 493.53 g/mol |
| Exact Mass | 493.15 |
| IUPAC Name | 5-[(S)-[2,5-difluoro-4-[[(3S,6R)-3-methyl-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]phenyl]-ethoxymethyl]-3H-1,3,4-oxadiazol-2-one |
| SMILES | CCO[C@H](c1n[nH]c(=O)o1)c1cc(F)c(CN2[C@@H](C)CC[C@H](c3ccccc3)S2(=O)=O)cc1F |
| InChI | InChI=1S/C23H25F2N3O5S/c1-3-32-21(22-26-27-23(29)33-22)17-12-18(24)16(11-19(17)25)13-28-14(2)9-10-20(34(28,30)31)15-7-5-4-6-8-15/h4-8,11-12,14,20-21H,3,9-10,13H2,1-2H3,(H,27,29)/t14-,20+,21-/m0/s1 |
| InChIKey | VQXRNOFRQPKULN-DLPLYFIVSA-N |
| XLogP | 3.82 |
| TPSA | 105.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.53 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |