C28H31ClN2O4S — CID 146595490
(3Z,5Z)-N-[(4S)-7-chloro-5'-methylspiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine]-7'-yl]sulfonyl-3-ethenylhepta-3,5-dienamide (PubChem CID 146595490) has the molecular formula C28H31ClN2O4S and a molecular weight of 527.09 g/mol. Its IUPAC name is (3Z,5Z)-N-[(4S)-7-chloro-5'-methylspiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine]-7'-yl]sulfonyl-3-ethenylhepta-3,5-dienamide.
| Compound Name | (3Z,5Z)-N-[(4S)-7-chloro-5'-methylspiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine]-7'-yl]sulfonyl-3-ethenylhepta-3,5-dienamide |
|---|---|
| PubChem CID | 146595490 |
| Molecular Formula | C28H31ClN2O4S |
| Molecular Weight | 527.09 g/mol |
| Exact Mass | 526.17 |
| IUPAC Name | (3Z,5Z)-N-[(4S)-7-chloro-5'-methylspiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine]-7'-yl]sulfonyl-3-ethenylhepta-3,5-dienamide |
| SMILES | C=C/C(=C\C=C/C)CC(=O)NS(=O)(=O)c1ccc2c(c1)N(C)C[C@@]1(CCCc3cc(Cl)ccc31)CO2 |
| InChI | InChI=1S/C28H31ClN2O4S/c1-4-6-8-20(5-2)15-27(32)30-36(33,34)23-11-13-26-25(17-23)31(3)18-28(19-35-26)14-7-9-21-16-22(29)10-12-24(21)28/h4-6,8,10-13,16-17H,2,7,9,14-15,18-19H2,1,3H3,(H,30,32)/b6-4-,20-8+/t28-/m0/s1 |
| InChIKey | SLHTUZICKGOCCC-IBAOOIRZSA-N |
| XLogP | 5.33 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.09 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|