C12H8N2NaO2S — CID 146598306
CID 146598306 (PubChem CID 146598306) has the molecular formula C12H8N2NaO2S and a molecular weight of 267.26 g/mol.
| Compound Name | CID 146598306 |
|---|---|
| PubChem CID | 146598306 |
| Molecular Formula | C12H8N2NaO2S |
| Molecular Weight | 267.26 g/mol |
| Exact Mass | 267.02 |
| IUPAC Name | — |
| SMILES | O=c1cc(O)nc(-c2csc3ccccc23)[nH]1.[Na] |
| InChI | InChI=1S/C12H8N2O2S.Na/c15-10-5-11(16)14-12(13-10)8-6-17-9-4-2-1-3-7(8)9;/h1-6H,(H2,13,14,15,16); |
| InChIKey | WMGKQTZFKMSWGE-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.26 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |