C18H14N2OS — CID 59872204
4-[[3-(1-benzothiophen-3-yl)-1H-pyrazol-5-yl]methyl]phenol (PubChem CID 59872204) has the molecular formula C18H14N2OS and a molecular weight of 306.39 g/mol. Its IUPAC name is 4-[[3-(1-benzothiophen-3-yl)-1H-pyrazol-5-yl]methyl]phenol.
| Compound Name | 4-[[3-(1-benzothiophen-3-yl)-1H-pyrazol-5-yl]methyl]phenol |
|---|---|
| PubChem CID | 59872204 |
| Molecular Formula | C18H14N2OS |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | 4-[[3-(1-benzothiophen-3-yl)-1H-pyrazol-5-yl]methyl]phenol |
| SMILES | Oc1ccc(Cc2cc(-c3csc4ccccc34)n[nH]2)cc1 |
| InChI | InChI=1S/C18H14N2OS/c21-14-7-5-12(6-8-14)9-13-10-17(20-19-13)16-11-22-18-4-2-1-3-15(16)18/h1-8,10-11,21H,9H2,(H,19,20) |
| InChIKey | GCDKNONNQFZWAH-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |