C15H21F2N3O4 — CID 146598383
4-[[4-[3-(difluoromethyl)-4-nitropyrazol-1-yl]cyclohexyl]methoxy]butanal (PubChem CID 146598383) has the molecular formula C15H21F2N3O4 and a molecular weight of 345.35 g/mol. Its IUPAC name is 4-[[4-[3-(difluoromethyl)-4-nitropyrazol-1-yl]cyclohexyl]methoxy]butanal.
| Compound Name | 4-[[4-[3-(difluoromethyl)-4-nitropyrazol-1-yl]cyclohexyl]methoxy]butanal |
|---|---|
| PubChem CID | 146598383 |
| Molecular Formula | C15H21F2N3O4 |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | 4-[[4-[3-(difluoromethyl)-4-nitropyrazol-1-yl]cyclohexyl]methoxy]butanal |
| SMILES | O=CCCCOCC1CCC(n2cc([N+](=O)[O-])c(C(F)F)n2)CC1 |
| InChI | InChI=1S/C15H21F2N3O4/c16-15(17)14-13(20(22)23)9-19(18-14)12-5-3-11(4-6-12)10-24-8-2-1-7-21/h7,9,11-12,15H,1-6,8,10H2 |
| InChIKey | VRDIDIIMGWTORM-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 87.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|