C12H17F2N3O5S — CID 146598534
[4-[3-(difluoromethyl)-4-nitropyrazol-1-yl]cyclohexyl]methyl methanesulfonate (PubChem CID 146598534) has the molecular formula C12H17F2N3O5S and a molecular weight of 353.35 g/mol. Its IUPAC name is [4-[3-(difluoromethyl)-4-nitropyrazol-1-yl]cyclohexyl]methyl methanesulfonate.
| Compound Name | [4-[3-(difluoromethyl)-4-nitropyrazol-1-yl]cyclohexyl]methyl methanesulfonate |
|---|---|
| PubChem CID | 146598534 |
| Molecular Formula | C12H17F2N3O5S |
| Molecular Weight | 353.35 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | [4-[3-(difluoromethyl)-4-nitropyrazol-1-yl]cyclohexyl]methyl methanesulfonate |
| SMILES | CS(=O)(=O)OCC1CCC(n2cc([N+](=O)[O-])c(C(F)F)n2)CC1 |
| InChI | InChI=1S/C12H17F2N3O5S/c1-23(20,21)22-7-8-2-4-9(5-3-8)16-6-10(17(18)19)11(15-16)12(13)14/h6,8-9,12H,2-5,7H2,1H3 |
| InChIKey | ZCMDYSAQJBTJEI-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 104.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.35 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|