C16H21F2N3O3 — CID 146598809
3-(difluoromethyl)-4-nitro-1-[4-(pent-4-ynoxymethyl)cyclohexyl]pyrazole (PubChem CID 146598809) has the molecular formula C16H21F2N3O3 and a molecular weight of 341.36 g/mol. Its IUPAC name is 3-(difluoromethyl)-4-nitro-1-[4-(pent-4-ynoxymethyl)cyclohexyl]pyrazole.
| Compound Name | 3-(difluoromethyl)-4-nitro-1-[4-(pent-4-ynoxymethyl)cyclohexyl]pyrazole |
|---|---|
| PubChem CID | 146598809 |
| Molecular Formula | C16H21F2N3O3 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | 3-(difluoromethyl)-4-nitro-1-[4-(pent-4-ynoxymethyl)cyclohexyl]pyrazole |
| SMILES | C#CCCCOCC1CCC(n2cc([N+](=O)[O-])c(C(F)F)n2)CC1 |
| InChI | InChI=1S/C16H21F2N3O3/c1-2-3-4-9-24-11-12-5-7-13(8-6-12)20-10-14(21(22)23)15(19-20)16(17)18/h1,10,12-13,16H,3-9,11H2 |
| InChIKey | MGAQVJGRVCHFQY-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 70.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|