C14H24F2N4O — CID 146598354
1-[4-(3-aminopropoxymethyl)cyclohexyl]-3-(difluoromethyl)pyrazol-4-amine (PubChem CID 146598354) has the molecular formula C14H24F2N4O and a molecular weight of 302.37 g/mol. Its IUPAC name is 1-[4-(3-aminopropoxymethyl)cyclohexyl]-3-(difluoromethyl)pyrazol-4-amine.
| Compound Name | 1-[4-(3-aminopropoxymethyl)cyclohexyl]-3-(difluoromethyl)pyrazol-4-amine |
|---|---|
| PubChem CID | 146598354 |
| Molecular Formula | C14H24F2N4O |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | 1-[4-(3-aminopropoxymethyl)cyclohexyl]-3-(difluoromethyl)pyrazol-4-amine |
| SMILES | NCCCOCC1CCC(n2cc(N)c(C(F)F)n2)CC1 |
| InChI | InChI=1S/C14H24F2N4O/c15-14(16)13-12(18)8-20(19-13)11-4-2-10(3-5-11)9-21-7-1-6-17/h8,10-11,14H,1-7,9,17-18H2 |
| InChIKey | SYHAHKDHHHFGKU-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 79.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|