C12H19F2N3O — CID 146598787
[4-[3-(difluoromethyl)-4-(methylamino)pyrazol-1-yl]cyclohexyl]methanol (PubChem CID 146598787) has the molecular formula C12H19F2N3O and a molecular weight of 259.30 g/mol. Its IUPAC name is [4-[3-(difluoromethyl)-4-(methylamino)pyrazol-1-yl]cyclohexyl]methanol.
| Compound Name | [4-[3-(difluoromethyl)-4-(methylamino)pyrazol-1-yl]cyclohexyl]methanol |
|---|---|
| PubChem CID | 146598787 |
| Molecular Formula | C12H19F2N3O |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.15 |
| IUPAC Name | [4-[3-(difluoromethyl)-4-(methylamino)pyrazol-1-yl]cyclohexyl]methanol |
| SMILES | CNc1cn(C2CCC(CO)CC2)nc1C(F)F |
| InChI | InChI=1S/C12H19F2N3O/c1-15-10-6-17(16-11(10)12(13)14)9-4-2-8(7-18)3-5-9/h6,8-9,12,15,18H,2-5,7H2,1H3 |
| InChIKey | YTVZXXYNOMDUIS-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |