C11H17F2N3O — CID 146598755
[4-[4-amino-5-(difluoromethyl)pyrazol-1-yl]cyclohexyl]methanol (PubChem CID 146598755) has the molecular formula C11H17F2N3O and a molecular weight of 245.27 g/mol. Its IUPAC name is [4-[4-amino-5-(difluoromethyl)pyrazol-1-yl]cyclohexyl]methanol.
| Compound Name | [4-[4-amino-5-(difluoromethyl)pyrazol-1-yl]cyclohexyl]methanol |
|---|---|
| PubChem CID | 146598755 |
| Molecular Formula | C11H17F2N3O |
| Molecular Weight | 245.27 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | [4-[4-amino-5-(difluoromethyl)pyrazol-1-yl]cyclohexyl]methanol |
| SMILES | Nc1cnn(C2CCC(CO)CC2)c1C(F)F |
| InChI | InChI=1S/C11H17F2N3O/c12-11(13)10-9(14)5-15-16(10)8-3-1-7(6-17)2-4-8/h5,7-8,11,17H,1-4,6,14H2 |
| InChIKey | NCGTUOUBCPPZAY-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.27 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |