C17H30F2N4O2 — CID 146599036
1-[4-[3-(3-aminopropoxy)propoxymethyl]cyclohexyl]-3-(difluoromethyl)pyrazol-4-amine (PubChem CID 146599036) has the molecular formula C17H30F2N4O2 and a molecular weight of 360.45 g/mol. Its IUPAC name is 1-[4-[3-(3-aminopropoxy)propoxymethyl]cyclohexyl]-3-(difluoromethyl)pyrazol-4-amine.
| Compound Name | 1-[4-[3-(3-aminopropoxy)propoxymethyl]cyclohexyl]-3-(difluoromethyl)pyrazol-4-amine |
|---|---|
| PubChem CID | 146599036 |
| Molecular Formula | C17H30F2N4O2 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | 1-[4-[3-(3-aminopropoxy)propoxymethyl]cyclohexyl]-3-(difluoromethyl)pyrazol-4-amine |
| SMILES | NCCCOCCCOCC1CCC(n2cc(N)c(C(F)F)n2)CC1 |
| InChI | InChI=1S/C17H30F2N4O2/c18-17(19)16-15(21)11-23(22-16)14-5-3-13(4-6-14)12-25-10-2-9-24-8-1-7-20/h11,13-14,17H,1-10,12,20-21H2 |
| InChIKey | SXPODTCUTIQGSQ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|