C32H40F2N6O6 — CID 146598635
4-[3-[1-[[4-[4-amino-3-(difluoromethyl)pyrazol-1-yl]cyclohexyl]methyl]piperidin-4-yl]oxypropoxy]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 146598635) has the molecular formula C32H40F2N6O6 and a molecular weight of 642.70 g/mol. Its IUPAC name is 4-[3-[1-[[4-[4-amino-3-(difluoromethyl)pyrazol-1-yl]cyclohexyl]methyl]piperidin-4-yl]oxypropoxy]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 4-[3-[1-[[4-[4-amino-3-(difluoromethyl)pyrazol-1-yl]cyclohexyl]methyl]piperidin-4-yl]oxypropoxy]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 146598635 |
| Molecular Formula | C32H40F2N6O6 |
| Molecular Weight | 642.70 g/mol |
| Exact Mass | 642.30 |
| IUPAC Name | 4-[3-[1-[[4-[4-amino-3-(difluoromethyl)pyrazol-1-yl]cyclohexyl]methyl]piperidin-4-yl]oxypropoxy]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | Nc1cn(C2CCC(CN3CCC(OCCCOc4cccc5c4C(=O)N(C4CCC(=O)NC4=O)C5=O)CC3)CC2)nc1C(F)F |
| InChI | InChI=1S/C32H40F2N6O6/c33-29(34)28-23(35)18-39(37-28)20-7-5-19(6-8-20)17-38-13-11-21(12-14-38)45-15-2-16-46-25-4-1-3-22-27(25)32(44)40(31(22)43)24-9-10-26(41)36-30(24)42/h1,3-4,18-21,24,29H,2,5-17,35H2,(H,36,41,42) |
| InChIKey | TVUJMGODLYXSIJ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 149.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.70 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|