C23H17F4N5O5 — CID 146635975
3-[5-fluoro-3-oxo-7-[[1-[4-(trifluoromethoxy)phenyl]triazol-4-yl]methoxy]-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 146635975) has the molecular formula C23H17F4N5O5 and a molecular weight of 519.41 g/mol. Its IUPAC name is 3-[5-fluoro-3-oxo-7-[[1-[4-(trifluoromethoxy)phenyl]triazol-4-yl]methoxy]-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[5-fluoro-3-oxo-7-[[1-[4-(trifluoromethoxy)phenyl]triazol-4-yl]methoxy]-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 146635975 |
| Molecular Formula | C23H17F4N5O5 |
| Molecular Weight | 519.41 g/mol |
| Exact Mass | 519.12 |
| IUPAC Name | 3-[5-fluoro-3-oxo-7-[[1-[4-(trifluoromethoxy)phenyl]triazol-4-yl]methoxy]-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3c(OCc4cn(-c5ccc(OC(F)(F)F)cc5)nn4)cc(F)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C23H17F4N5O5/c24-12-7-16-17(10-31(22(16)35)18-5-6-20(33)28-21(18)34)19(8-12)36-11-13-9-32(30-29-13)14-1-3-15(4-2-14)37-23(25,26)27/h1-4,7-9,18H,5-6,10-11H2,(H,28,33,34) |
| InChIKey | ADQVCGRRTCAGSB-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 115.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.41 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|