C22H38F2N4O2 — CID 146599370
tert-butyl N-[1-[4-(7-aminoheptyl)cyclohexyl]-3-(difluoromethyl)pyrazol-4-yl]carbamate (PubChem CID 146599370) has the molecular formula C22H38F2N4O2 and a molecular weight of 428.57 g/mol. Its IUPAC name is tert-butyl N-[1-[4-(7-aminoheptyl)cyclohexyl]-3-(difluoromethyl)pyrazol-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[4-(7-aminoheptyl)cyclohexyl]-3-(difluoromethyl)pyrazol-4-yl]carbamate |
|---|---|
| PubChem CID | 146599370 |
| Molecular Formula | C22H38F2N4O2 |
| Molecular Weight | 428.57 g/mol |
| Exact Mass | 428.30 |
| IUPAC Name | tert-butyl N-[1-[4-(7-aminoheptyl)cyclohexyl]-3-(difluoromethyl)pyrazol-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cn(C2CCC(CCCCCCCN)CC2)nc1C(F)F |
| InChI | InChI=1S/C22H38F2N4O2/c1-22(2,3)30-21(29)26-18-15-28(27-19(18)20(23)24)17-12-10-16(11-13-17)9-7-5-4-6-8-14-25/h15-17,20H,4-14,25H2,1-3H3,(H,26,29) |
| InChIKey | YOFOPZUJZZCOGE-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.57 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|