C16H23F2N3O3 — CID 146598357
tert-butyl N-[3-(difluoromethyl)-1-(4-formylcyclohexyl)pyrazol-4-yl]carbamate (PubChem CID 146598357) has the molecular formula C16H23F2N3O3 and a molecular weight of 343.37 g/mol. Its IUPAC name is tert-butyl N-[3-(difluoromethyl)-1-(4-formylcyclohexyl)pyrazol-4-yl]carbamate.
| Compound Name | tert-butyl N-[3-(difluoromethyl)-1-(4-formylcyclohexyl)pyrazol-4-yl]carbamate |
|---|---|
| PubChem CID | 146598357 |
| Molecular Formula | C16H23F2N3O3 |
| Molecular Weight | 343.37 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | tert-butyl N-[3-(difluoromethyl)-1-(4-formylcyclohexyl)pyrazol-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cn(C2CCC(C=O)CC2)nc1C(F)F |
| InChI | InChI=1S/C16H23F2N3O3/c1-16(2,3)24-15(23)19-12-8-21(20-13(12)14(17)18)11-6-4-10(9-22)5-7-11/h8-11,14H,4-7H2,1-3H3,(H,19,23) |
| InChIKey | ZNJSTQDPBPQCDI-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.37 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|