C16H24F3N3O3 — CID 146599678
tert-butyl N-[1-[4-(hydroxymethyl)cyclohexyl]-3-(trifluoromethyl)pyrazol-4-yl]carbamate (PubChem CID 146599678) has the molecular formula C16H24F3N3O3 and a molecular weight of 363.38 g/mol. Its IUPAC name is tert-butyl N-[1-[4-(hydroxymethyl)cyclohexyl]-3-(trifluoromethyl)pyrazol-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[4-(hydroxymethyl)cyclohexyl]-3-(trifluoromethyl)pyrazol-4-yl]carbamate |
|---|---|
| PubChem CID | 146599678 |
| Molecular Formula | C16H24F3N3O3 |
| Molecular Weight | 363.38 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | tert-butyl N-[1-[4-(hydroxymethyl)cyclohexyl]-3-(trifluoromethyl)pyrazol-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cn(C2CCC(CO)CC2)nc1C(F)(F)F |
| InChI | InChI=1S/C16H24F3N3O3/c1-15(2,3)25-14(24)20-12-8-22(21-13(12)16(17,18)19)11-6-4-10(9-23)5-7-11/h8,10-11,23H,4-7,9H2,1-3H3,(H,20,24) |
| InChIKey | GOGWBMZSQQVOCF-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.38 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |