C33H51IN2O14 — CID 146600006
(2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[4-[3-[2-[2-[2-[6-[(2-iodoacetyl)amino]hexanoylamino]ethoxy]ethoxy]ethoxy]propyl]-2-(propanoyloxymethyl)phenoxy]oxane-2-carboxylic acid (PubChem CID 146600006) has the molecular formula C33H51IN2O14 and a molecular weight of 826.67 g/mol. Its IUPAC name is (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[4-[3-[2-[2-[2-[6-[(2-iodoacetyl)amino]hexanoylamino]ethoxy]ethoxy]ethoxy]propyl]-2-(propanoyloxymethyl)phenoxy]oxane-2-carboxylic acid.
| Compound Name | (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[4-[3-[2-[2-[2-[6-[(2-iodoacetyl)amino]hexanoylamino]ethoxy]ethoxy]ethoxy]propyl]-2-(propanoyloxymethyl)phenoxy]oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 146600006 |
| Molecular Formula | C33H51IN2O14 |
| Molecular Weight | 826.67 g/mol |
| Exact Mass | 826.24 |
| IUPAC Name | (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[4-[3-[2-[2-[2-[6-[(2-iodoacetyl)amino]hexanoylamino]ethoxy]ethoxy]ethoxy]propyl]-2-(propanoyloxymethyl)phenoxy]oxane-2-carboxylic acid |
| SMILES | CCC(=O)OCc1cc(CCCOCCOCCOCCNC(=O)CCCCCNC(=O)CI)ccc1O[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C33H51IN2O14/c1-2-27(39)48-21-23-19-22(9-10-24(23)49-33-30(42)28(40)29(41)31(50-33)32(43)44)7-6-13-45-15-17-47-18-16-46-14-12-36-25(37)8-4-3-5-11-35-26(38)20-34/h9-10,19,28-31,33,40-42H,2-8,11-18,20-21H2,1H3,(H,35,38)(H,36,37)(H,43,44)/t28-,29-,30+,31-,33+/m0/s1 |
| InChIKey | LSQYOEFYHYMBIL-XMOLDCRASA-N |
| XLogP | 0.62 |
| TPSA | 228.64 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 826.67 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|