C34H29N3O3 — CID 146600650
2,4-diphenyl-6-[8-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)dibenzofuran-1-yl]-1,3,5-triazine (PubChem CID 146600650) has the molecular formula C34H29N3O3 and a molecular weight of 527.62 g/mol. Its IUPAC name is 2,4-diphenyl-6-[8-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)dibenzofuran-1-yl]-1,3,5-triazine.
| Compound Name | 2,4-diphenyl-6-[8-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)dibenzofuran-1-yl]-1,3,5-triazine |
|---|---|
| PubChem CID | 146600650 |
| Molecular Formula | C34H29N3O3 |
| Molecular Weight | 527.62 g/mol |
| Exact Mass | 527.22 |
| IUPAC Name | 2,4-diphenyl-6-[8-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)dibenzofuran-1-yl]-1,3,5-triazine |
| SMILES | CC1(C)OC(c2ccc3oc4cccc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)c4c3c2)OC1(C)C |
| InChI | InChI=1S/C34H29N3O3/c1-33(2)34(3,4)40-32(39-33)23-18-19-26-25(20-23)28-24(16-11-17-27(28)38-26)31-36-29(21-12-7-5-8-13-21)35-30(37-31)22-14-9-6-10-15-22/h5-20,32H,1-4H3 |
| InChIKey | RANYHOPEPRVNAO-UHFFFAOYSA-N |
| XLogP | 8.37 |
| TPSA | 70.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.62 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |