C17H21ClN2O — CID 146604568
(5-chloro-1-propan-2-ylindol-2-yl)-piperidin-1-ylmethanone (PubChem CID 146604568) has the molecular formula C17H21ClN2O and a molecular weight of 304.82 g/mol. Its IUPAC name is (5-chloro-1-propan-2-ylindol-2-yl)-piperidin-1-ylmethanone.
| Compound Name | (5-chloro-1-propan-2-ylindol-2-yl)-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 146604568 |
| Molecular Formula | C17H21ClN2O |
| Molecular Weight | 304.82 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | (5-chloro-1-propan-2-ylindol-2-yl)-piperidin-1-ylmethanone |
| SMILES | CC(C)n1c(C(=O)N2CCCCC2)cc2cc(Cl)ccc21 |
| InChI | InChI=1S/C17H21ClN2O/c1-12(2)20-15-7-6-14(18)10-13(15)11-16(20)17(21)19-8-4-3-5-9-19/h6-7,10-12H,3-5,8-9H2,1-2H3 |
| InChIKey | NUYPSPXGQCPPPM-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.82 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |