C19H23ClN4O3 — CID 3972917
5-chloro-1-methyl-N'-(4-oxo-4-piperidin-1-ylbutanoyl)indole-2-carbohydrazide (PubChem CID 3972917) has the molecular formula C19H23ClN4O3 and a molecular weight of 390.87 g/mol. Its IUPAC name is 5-chloro-1-methyl-N'-(4-oxo-4-piperidin-1-ylbutanoyl)indole-2-carbohydrazide.
| Compound Name | 5-chloro-1-methyl-N'-(4-oxo-4-piperidin-1-ylbutanoyl)indole-2-carbohydrazide |
|---|---|
| PubChem CID | 3972917 |
| Molecular Formula | C19H23ClN4O3 |
| Molecular Weight | 390.87 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | 5-chloro-1-methyl-N'-(4-oxo-4-piperidin-1-ylbutanoyl)indole-2-carbohydrazide |
| SMILES | Cn1c(C(=O)NNC(=O)CCC(=O)N2CCCCC2)cc2cc(Cl)ccc21 |
| InChI | InChI=1S/C19H23ClN4O3/c1-23-15-6-5-14(20)11-13(15)12-16(23)19(27)22-21-17(25)7-8-18(26)24-9-3-2-4-10-24/h5-6,11-12H,2-4,7-10H2,1H3,(H,21,25)(H,22,27) |
| InChIKey | IYNJGAXFWJCJTG-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 83.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.87 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|