C18H12F2N2O3S — CID 146604647
2-cyclopropyl-1-(3,5-difluoro-2-hydroxyphenyl)sulfonylindole-5-carbonitrile (PubChem CID 146604647) has the molecular formula C18H12F2N2O3S and a molecular weight of 374.37 g/mol. Its IUPAC name is 2-cyclopropyl-1-(3,5-difluoro-2-hydroxyphenyl)sulfonylindole-5-carbonitrile.
| Compound Name | 2-cyclopropyl-1-(3,5-difluoro-2-hydroxyphenyl)sulfonylindole-5-carbonitrile |
|---|---|
| PubChem CID | 146604647 |
| Molecular Formula | C18H12F2N2O3S |
| Molecular Weight | 374.37 g/mol |
| Exact Mass | 374.05 |
| IUPAC Name | 2-cyclopropyl-1-(3,5-difluoro-2-hydroxyphenyl)sulfonylindole-5-carbonitrile |
| SMILES | N#Cc1ccc2c(c1)cc(C1CC1)n2S(=O)(=O)c1cc(F)cc(F)c1O |
| InChI | InChI=1S/C18H12F2N2O3S/c19-13-7-14(20)18(23)17(8-13)26(24,25)22-15-4-1-10(9-21)5-12(15)6-16(22)11-2-3-11/h1,4-8,11,23H,2-3H2 |
| InChIKey | WAHBUQGZWVORHP-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.37 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfonamide_A(43)', 'substructure': 'N/A'} |
|---|