C16H14N2O2S — CID 70811927
1-cyclohexa-1,3-dien-1-ylsulfonyl-2-methylindole-5-carbonitrile (PubChem CID 70811927) has the molecular formula C16H14N2O2S and a molecular weight of 298.37 g/mol. Its IUPAC name is 1-cyclohexa-1,3-dien-1-ylsulfonyl-2-methylindole-5-carbonitrile.
| Compound Name | 1-cyclohexa-1,3-dien-1-ylsulfonyl-2-methylindole-5-carbonitrile |
|---|---|
| PubChem CID | 70811927 |
| Molecular Formula | C16H14N2O2S |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 1-cyclohexa-1,3-dien-1-ylsulfonyl-2-methylindole-5-carbonitrile |
| SMILES | Cc1cc2cc(C#N)ccc2n1S(=O)(=O)C1=CC=CCC1 |
| InChI | InChI=1S/C16H14N2O2S/c1-12-9-14-10-13(11-17)7-8-16(14)18(12)21(19,20)15-5-3-2-4-6-15/h2-3,5,7-10H,4,6H2,1H3 |
| InChIKey | APPFBSHQEOMILE-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 62.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |