C22H11F5N2O4S — CID 146604343
1-(3,5-difluoro-2-hydroxyphenyl)sulfonyl-2-[4-(trifluoromethoxy)phenyl]indole-5-carbonitrile (PubChem CID 146604343) has the molecular formula C22H11F5N2O4S and a molecular weight of 494.40 g/mol. Its IUPAC name is 1-(3,5-difluoro-2-hydroxyphenyl)sulfonyl-2-[4-(trifluoromethoxy)phenyl]indole-5-carbonitrile.
| Compound Name | 1-(3,5-difluoro-2-hydroxyphenyl)sulfonyl-2-[4-(trifluoromethoxy)phenyl]indole-5-carbonitrile |
|---|---|
| PubChem CID | 146604343 |
| Molecular Formula | C22H11F5N2O4S |
| Molecular Weight | 494.40 g/mol |
| Exact Mass | 494.04 |
| IUPAC Name | 1-(3,5-difluoro-2-hydroxyphenyl)sulfonyl-2-[4-(trifluoromethoxy)phenyl]indole-5-carbonitrile |
| SMILES | N#Cc1ccc2c(c1)cc(-c1ccc(OC(F)(F)F)cc1)n2S(=O)(=O)c1cc(F)cc(F)c1O |
| InChI | InChI=1S/C22H11F5N2O4S/c23-15-9-17(24)21(30)20(10-15)34(31,32)29-18-6-1-12(11-28)7-14(18)8-19(29)13-2-4-16(5-3-13)33-22(25,26)27/h1-10,30H |
| InChIKey | IHLQOBFMEVRLKK-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.40 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfonamide_A(43)', 'substructure': 'N/A'} |
|---|