C14H6F5NO — CID 57354954
4-[difluoro-(2,3,4-trifluorophenyl)methoxy]benzonitrile (PubChem CID 57354954) has the molecular formula C14H6F5NO and a molecular weight of 299.20 g/mol. Its IUPAC name is 4-[difluoro-(2,3,4-trifluorophenyl)methoxy]benzonitrile.
| Compound Name | 4-[difluoro-(2,3,4-trifluorophenyl)methoxy]benzonitrile |
|---|---|
| PubChem CID | 57354954 |
| Molecular Formula | C14H6F5NO |
| Molecular Weight | 299.20 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | 4-[difluoro-(2,3,4-trifluorophenyl)methoxy]benzonitrile |
| SMILES | N#Cc1ccc(OC(F)(F)c2ccc(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C14H6F5NO/c15-11-6-5-10(12(16)13(11)17)14(18,19)21-9-3-1-8(7-20)2-4-9/h1-6H |
| InChIKey | BCOHFRFCAVLHHI-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.20 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|