C24H24N6O2 — CID 1466114
N-[(1S)-2-(cyclopentylamino)-2-oxo-1-phenylethyl]-N-[3-methyl-4-(tetrazol-1-yl)phenyl]prop-2-ynamide (PubChem CID 1466114) has the molecular formula C24H24N6O2 and a molecular weight of 428.50 g/mol. Its IUPAC name is N-[(1S)-2-(cyclopentylamino)-2-oxo-1-phenylethyl]-N-[3-methyl-4-(tetrazol-1-yl)phenyl]prop-2-ynamide.
| Compound Name | N-[(1S)-2-(cyclopentylamino)-2-oxo-1-phenylethyl]-N-[3-methyl-4-(tetrazol-1-yl)phenyl]prop-2-ynamide |
|---|---|
| PubChem CID | 1466114 |
| Molecular Formula | C24H24N6O2 |
| Molecular Weight | 428.50 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | N-[(1S)-2-(cyclopentylamino)-2-oxo-1-phenylethyl]-N-[3-methyl-4-(tetrazol-1-yl)phenyl]prop-2-ynamide |
| SMILES | C#CC(=O)N(c1ccc(-n2cnnn2)c(C)c1)[C@H](C(=O)NC1CCCC1)c1ccccc1 |
| InChI | InChI=1S/C24H24N6O2/c1-3-22(31)30(20-13-14-21(17(2)15-20)29-16-25-27-28-29)23(18-9-5-4-6-10-18)24(32)26-19-11-7-8-12-19/h1,4-6,9-10,13-16,19,23H,7-8,11-12H2,2H3,(H,26,32)/t23-/m0/s1 |
| InChIKey | KIJWMNGYJJJHAB-QHCPKHFHSA-N |
| XLogP | 2.74 |
| TPSA | 93.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.50 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|