C23H22N2O4 — CID 1466116
N-(1,3-benzodioxol-5-yl)-N-[(1S)-2-(cyclopentylamino)-2-oxo-1-phenylethyl]prop-2-ynamide (PubChem CID 1466116) has the molecular formula C23H22N2O4 and a molecular weight of 390.44 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-N-[(1S)-2-(cyclopentylamino)-2-oxo-1-phenylethyl]prop-2-ynamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-N-[(1S)-2-(cyclopentylamino)-2-oxo-1-phenylethyl]prop-2-ynamide |
|---|---|
| PubChem CID | 1466116 |
| Molecular Formula | C23H22N2O4 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-N-[(1S)-2-(cyclopentylamino)-2-oxo-1-phenylethyl]prop-2-ynamide |
| SMILES | C#CC(=O)N(c1ccc2c(c1)OCO2)[C@H](C(=O)NC1CCCC1)c1ccccc1 |
| InChI | InChI=1S/C23H22N2O4/c1-2-21(26)25(18-12-13-19-20(14-18)29-15-28-19)22(16-8-4-3-5-9-16)23(27)24-17-10-6-7-11-17/h1,3-5,8-9,12-14,17,22H,6-7,10-11,15H2,(H,24,27)/t22-/m0/s1 |
| InChIKey | HNWBLSKKIQLLAG-QFIPXVFZSA-N |
| XLogP | 3.18 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|