C15H14F3N5O3 — CID 146615118
[5-[(3,4,5-trifluorophenyl)carbamoyl]-6,7-dihydro-4H-triazolo[1,5-a]pyrazin-3-yl]methyl acetate (PubChem CID 146615118) has the molecular formula C15H14F3N5O3 and a molecular weight of 369.30 g/mol. Its IUPAC name is [5-[(3,4,5-trifluorophenyl)carbamoyl]-6,7-dihydro-4H-triazolo[1,5-a]pyrazin-3-yl]methyl acetate.
| Compound Name | [5-[(3,4,5-trifluorophenyl)carbamoyl]-6,7-dihydro-4H-triazolo[1,5-a]pyrazin-3-yl]methyl acetate |
|---|---|
| PubChem CID | 146615118 |
| Molecular Formula | C15H14F3N5O3 |
| Molecular Weight | 369.30 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | [5-[(3,4,5-trifluorophenyl)carbamoyl]-6,7-dihydro-4H-triazolo[1,5-a]pyrazin-3-yl]methyl acetate |
| SMILES | CC(=O)OCc1nnn2c1CN(C(=O)Nc1cc(F)c(F)c(F)c1)CC2 |
| InChI | InChI=1S/C15H14F3N5O3/c1-8(24)26-7-12-13-6-22(2-3-23(13)21-20-12)15(25)19-9-4-10(16)14(18)11(17)5-9/h4-5H,2-3,6-7H2,1H3,(H,19,25) |
| InChIKey | BHTUELDLLYBBAS-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.30 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|