C19H19F3N4O3 — CID 160739871
3-[2-[(3R)-oxolan-3-yl]acetyl]-N-(3,4,5-trifluorophenyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxamide (PubChem CID 160739871) has the molecular formula C19H19F3N4O3 and a molecular weight of 408.38 g/mol. Its IUPAC name is 3-[2-[(3R)-oxolan-3-yl]acetyl]-N-(3,4,5-trifluorophenyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxamide.
| Compound Name | 3-[2-[(3R)-oxolan-3-yl]acetyl]-N-(3,4,5-trifluorophenyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxamide |
|---|---|
| PubChem CID | 160739871 |
| Molecular Formula | C19H19F3N4O3 |
| Molecular Weight | 408.38 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | 3-[2-[(3R)-oxolan-3-yl]acetyl]-N-(3,4,5-trifluorophenyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxamide |
| SMILES | O=C(C[C@H]1CCOC1)c1cnn2c1CN(C(=O)Nc1cc(F)c(F)c(F)c1)CC2 |
| InChI | InChI=1S/C19H19F3N4O3/c20-14-6-12(7-15(21)18(14)22)24-19(28)25-2-3-26-16(9-25)13(8-23-26)17(27)5-11-1-4-29-10-11/h6-8,11H,1-5,9-10H2,(H,24,28)/t11-/m1/s1 |
| InChIKey | UOCIUPGTEMQNDO-LLVKDONJSA-N |
| XLogP | 2.96 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.38 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|