C9H13N3O5S — CID 146616043
2-[4-(ethylcarbamoyl)pyridazin-1-ium-1-yl]ethyl sulfate (PubChem CID 146616043) has the molecular formula C9H13N3O5S and a molecular weight of 275.29 g/mol. Its IUPAC name is 2-[4-(ethylcarbamoyl)pyridazin-1-ium-1-yl]ethyl sulfate.
| Compound Name | 2-[4-(ethylcarbamoyl)pyridazin-1-ium-1-yl]ethyl sulfate |
|---|---|
| PubChem CID | 146616043 |
| Molecular Formula | C9H13N3O5S |
| Molecular Weight | 275.29 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | 2-[4-(ethylcarbamoyl)pyridazin-1-ium-1-yl]ethyl sulfate |
| SMILES | CCNC(=O)c1cc[n+](CCOS(=O)(=O)[O-])nc1 |
| InChI | InChI=1S/C9H13N3O5S/c1-2-10-9(13)8-3-4-12(11-7-8)5-6-17-18(14,15)16/h3-4,7H,2,5-6H2,1H3,(H-,10,13,14,15,16) |
| InChIKey | BVOIIEUIRMGAFZ-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 112.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.29 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|