C17H26Si2 — CID 14662043
trimethyl-[2-[7-(2-trimethylsilylethynyl)-1-tricyclo[4.1.0.02,7]heptanyl]ethynyl]silane (PubChem CID 14662043) has the molecular formula C17H26Si2 and a molecular weight of 286.57 g/mol. Its IUPAC name is trimethyl-[2-[7-(2-trimethylsilylethynyl)-1-tricyclo[4.1.0.02,7]heptanyl]ethynyl]silane.
| Compound Name | trimethyl-[2-[7-(2-trimethylsilylethynyl)-1-tricyclo[4.1.0.02,7]heptanyl]ethynyl]silane |
|---|---|
| PubChem CID | 14662043 |
| Molecular Formula | C17H26Si2 |
| Molecular Weight | 286.57 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | trimethyl-[2-[7-(2-trimethylsilylethynyl)-1-tricyclo[4.1.0.02,7]heptanyl]ethynyl]silane |
| SMILES | C[Si](C)(C)C#CC12C3CCCC1C32C#C[Si](C)(C)C |
| InChI | InChI=1S/C17H26Si2/c1-18(2,3)12-10-16-14-8-7-9-15(16)17(14,16)11-13-19(4,5)6/h14-15H,7-9H2,1-6H3 |
| InChIKey | MKBNDUTVIQLYOZ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.57 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|