C12H18Si — CID 14662037
trimethyl-[2-(1-tricyclo[4.1.0.02,7]heptanyl)ethynyl]silane (PubChem CID 14662037) has the molecular formula C12H18Si and a molecular weight of 190.36 g/mol. Its IUPAC name is trimethyl-[2-(1-tricyclo[4.1.0.02,7]heptanyl)ethynyl]silane.
| Compound Name | trimethyl-[2-(1-tricyclo[4.1.0.02,7]heptanyl)ethynyl]silane |
|---|---|
| PubChem CID | 14662037 |
| Molecular Formula | C12H18Si |
| Molecular Weight | 190.36 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | trimethyl-[2-(1-tricyclo[4.1.0.02,7]heptanyl)ethynyl]silane |
| SMILES | C[Si](C)(C)C#CC12C3CCCC1C32 |
| InChI | InChI=1S/C12H18Si/c1-13(2,3)8-7-12-9-5-4-6-10(12)11(9)12/h9-11H,4-6H2,1-3H3 |
| InChIKey | HTYCXAWKVJVALR-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.36 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|