C13H18 — CID 15758535
1-hex-1-ynyltricyclo[4.1.0.02,7]heptane (PubChem CID 15758535) has the molecular formula C13H18 and a molecular weight of 174.29 g/mol. Its IUPAC name is 1-hex-1-ynyltricyclo[4.1.0.02,7]heptane.
| Compound Name | 1-hex-1-ynyltricyclo[4.1.0.02,7]heptane |
|---|---|
| PubChem CID | 15758535 |
| Molecular Formula | C13H18 |
| Molecular Weight | 174.29 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | 1-hex-1-ynyltricyclo[4.1.0.02,7]heptane |
| SMILES | CCCCC#CC12C3CCCC1C32 |
| InChI | InChI=1S/C13H18/c1-2-3-4-5-9-13-10-7-6-8-11(13)12(10)13/h10-12H,2-4,6-8H2,1H3 |
| InChIKey | DWNQFJFLFFQBLB-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.29 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|