C9H9Br — CID 14662039
1-(2-bromoethynyl)tricyclo[4.1.0.02,7]heptane (PubChem CID 14662039) has the molecular formula C9H9Br and a molecular weight of 197.07 g/mol. Its IUPAC name is 1-(2-bromoethynyl)tricyclo[4.1.0.02,7]heptane.
| Compound Name | 1-(2-bromoethynyl)tricyclo[4.1.0.02,7]heptane |
|---|---|
| PubChem CID | 14662039 |
| Molecular Formula | C9H9Br |
| Molecular Weight | 197.07 g/mol |
| Exact Mass | 195.99 |
| IUPAC Name | 1-(2-bromoethynyl)tricyclo[4.1.0.02,7]heptane |
| SMILES | BrC#CC12C3CCCC1C32 |
| InChI | InChI=1S/C9H9Br/c10-5-4-9-6-2-1-3-7(9)8(6)9/h6-8H,1-3H2 |
| InChIKey | CSQRUTHRVUXXGV-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.07 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|