C9H10 — CID 14662038
1-ethynyltricyclo[4.1.0.02,7]heptane (PubChem CID 14662038) has the molecular formula C9H10 and a molecular weight of 118.18 g/mol. Its IUPAC name is 1-ethynyltricyclo[4.1.0.02,7]heptane.
| Compound Name | 1-ethynyltricyclo[4.1.0.02,7]heptane |
|---|---|
| PubChem CID | 14662038 |
| Molecular Formula | C9H10 |
| Molecular Weight | 118.18 g/mol |
| Exact Mass | 118.08 |
| IUPAC Name | 1-ethynyltricyclo[4.1.0.02,7]heptane |
| SMILES | C#CC12C3CCCC1C32 |
| InChI | InChI=1S/C9H10/c1-2-9-6-4-3-5-7(9)8(6)9/h1,6-8H,3-5H2 |
| InChIKey | AYQKDGJLFYJODP-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 118.18 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|