C18H26Si — CID 15758537
2-[7-(3,3-dimethylbut-1-ynyl)-1-tricyclo[4.1.0.02,7]heptanyl]ethynyl-trimethylsilane (PubChem CID 15758537) has the molecular formula C18H26Si and a molecular weight of 270.49 g/mol. Its IUPAC name is 2-[7-(3,3-dimethylbut-1-ynyl)-1-tricyclo[4.1.0.02,7]heptanyl]ethynyl-trimethylsilane.
| Compound Name | 2-[7-(3,3-dimethylbut-1-ynyl)-1-tricyclo[4.1.0.02,7]heptanyl]ethynyl-trimethylsilane |
|---|---|
| PubChem CID | 15758537 |
| Molecular Formula | C18H26Si |
| Molecular Weight | 270.49 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | 2-[7-(3,3-dimethylbut-1-ynyl)-1-tricyclo[4.1.0.02,7]heptanyl]ethynyl-trimethylsilane |
| SMILES | CC(C)(C)C#CC12C3CCCC1C32C#C[Si](C)(C)C |
| InChI | InChI=1S/C18H26Si/c1-16(2,3)10-11-17-14-8-7-9-15(17)18(14,17)12-13-19(4,5)6/h14-15H,7-9H2,1-6H3 |
| InChIKey | YPIHFEPBZFILRH-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.49 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|