About 5-(3,4-dihydro-2H-pyrrol-5-yl)-2,3-dihydropyridine
5-(3,4-dihydro-2H-pyrrol-5-yl)-2,3-dihydropyridine (PubChem CID 146620666) has the molecular formula C9H12N2
and a molecular weight of 148.21 g/mol. Its IUPAC name is 5-(3,4-dihydro-2H-pyrrol-5-yl)-2,3-dihydropyridine.
Analyze 5-(3,4-dihydro-2H-pyrrol-5-yl)-2,3-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,4-dihydro-2H-pyrrol-5-yl)-2,3-dihydropyridine?
The IUPAC name of 5-(3,4-dihydro-2H-pyrrol-5-yl)-2,3-dihydropyridine (CID 146620666) is 5-(3,4-dihydro-2H-pyrrol-5-yl)-2,3-dihydropyridine.
What is the SMILES notation for 5-(3,4-dihydro-2H-pyrrol-5-yl)-2,3-dihydropyridine?
The canonical SMILES for 5-(3,4-dihydro-2H-pyrrol-5-yl)-2,3-dihydropyridine is C1=NCCC=C1C1=NCCC1.
What is the InChIKey of 5-(3,4-dihydro-2H-pyrrol-5-yl)-2,3-dihydropyridine?
The InChIKey is WBKMDVHSXAAUQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2/c1-3-8(7-10-5-1)9-4-2-6-11-9/h3,7H,1-2,4-6H2.
What are the key properties of 5-(3,4-dihydro-2H-pyrrol-5-yl)-2,3-dihydropyridine?
5-(3,4-dihydro-2H-pyrrol-5-yl)-2,3-dihydropyridine has a molecular weight of 148.21 g/mol, XLogP of 1.62, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,4-dihydro-2H-pyrrol-5-yl)-2,3-dihydropyridine is sourced from PubChem (CID 146620666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).