C28H37N5O2 — CID 146622550
2-amino-4-[(dipropylamino)-hydroxymethyl]-N-[(3S)-1-phenylpyrrolidin-3-yl]-3H-1-benzazepine-8-carboxamide (PubChem CID 146622550) has the molecular formula C28H37N5O2 and a molecular weight of 475.64 g/mol. Its IUPAC name is 2-amino-4-[(dipropylamino)-hydroxymethyl]-N-[(3S)-1-phenylpyrrolidin-3-yl]-3H-1-benzazepine-8-carboxamide.
| Compound Name | 2-amino-4-[(dipropylamino)-hydroxymethyl]-N-[(3S)-1-phenylpyrrolidin-3-yl]-3H-1-benzazepine-8-carboxamide |
|---|---|
| PubChem CID | 146622550 |
| Molecular Formula | C28H37N5O2 |
| Molecular Weight | 475.64 g/mol |
| Exact Mass | 475.29 |
| IUPAC Name | 2-amino-4-[(dipropylamino)-hydroxymethyl]-N-[(3S)-1-phenylpyrrolidin-3-yl]-3H-1-benzazepine-8-carboxamide |
| SMILES | CCCN(CCC)C(O)C1=Cc2ccc(C(=O)N[C@H]3CCN(c4ccccc4)C3)cc2N=C(N)C1 |
| InChI | InChI=1S/C28H37N5O2/c1-3-13-32(14-4-2)28(35)22-16-20-10-11-21(17-25(20)31-26(29)18-22)27(34)30-23-12-15-33(19-23)24-8-6-5-7-9-24/h5-11,16-17,23,28,35H,3-4,12-15,18-19H2,1-2H3,(H2,29,31)(H,30,34)/t23-,28?/m0/s1 |
| InChIKey | SNOBOMUGEQSOMD-UHFKCPIBSA-N |
| XLogP | 3.91 |
| TPSA | 94.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.64 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|