C36H43N7O7S — CID 146627006
[[2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]oxyphenyl]acetyl]-[5-[4-[6-[(2-phenylacetyl)amino]pyridazin-3-yl]butyl]-1,3,4-thiadiazol-2-yl]amino]methyl butanoate (PubChem CID 146627006) has the molecular formula C36H43N7O7S and a molecular weight of 717.85 g/mol. Its IUPAC name is [[2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]oxyphenyl]acetyl]-[5-[4-[6-[(2-phenylacetyl)amino]pyridazin-3-yl]butyl]-1,3,4-thiadiazol-2-yl]amino]methyl butanoate.
| Compound Name | [[2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]oxyphenyl]acetyl]-[5-[4-[6-[(2-phenylacetyl)amino]pyridazin-3-yl]butyl]-1,3,4-thiadiazol-2-yl]amino]methyl butanoate |
|---|---|
| PubChem CID | 146627006 |
| Molecular Formula | C36H43N7O7S |
| Molecular Weight | 717.85 g/mol |
| Exact Mass | 717.29 |
| IUPAC Name | [[2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]oxyphenyl]acetyl]-[5-[4-[6-[(2-phenylacetyl)amino]pyridazin-3-yl]butyl]-1,3,4-thiadiazol-2-yl]amino]methyl butanoate |
| SMILES | CCCC(=O)OCN(C(=O)Cc1cccc(ONC(=O)OC(C)(C)C)c1)c1nnc(CCCCc2ccc(NC(=O)Cc3ccccc3)nn2)s1 |
| InChI | InChI=1S/C36H43N7O7S/c1-5-12-33(46)48-24-43(32(45)23-26-15-11-17-28(21-26)50-42-35(47)49-36(2,3)4)34-41-40-31(51-34)18-10-9-16-27-19-20-29(39-38-27)37-30(44)22-25-13-7-6-8-14-25/h6-8,11,13-15,17,19-21H,5,9-10,12,16,18,22-24H2,1-4H3,(H,42,47)(H,37,39,44) |
| InChIKey | XNQQIJGAOJEFNA-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 174.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.85 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|