C32H35F3N6O5S — CID 123310211
[(2-cyclohexa-1,5-dien-1-ylacetyl)-[5-[4-[6-[[2-[3-(trifluoromethoxy)phenyl]acetyl]amino]pyridazin-3-yl]butyl]-1,3,4-thiadiazol-2-yl]amino]methyl butanoate (PubChem CID 123310211) has the molecular formula C32H35F3N6O5S and a molecular weight of 672.73 g/mol. Its IUPAC name is [(2-cyclohexa-1,5-dien-1-ylacetyl)-[5-[4-[6-[[2-[3-(trifluoromethoxy)phenyl]acetyl]amino]pyridazin-3-yl]butyl]-1,3,4-thiadiazol-2-yl]amino]methyl butanoate.
| Compound Name | [(2-cyclohexa-1,5-dien-1-ylacetyl)-[5-[4-[6-[[2-[3-(trifluoromethoxy)phenyl]acetyl]amino]pyridazin-3-yl]butyl]-1,3,4-thiadiazol-2-yl]amino]methyl butanoate |
|---|---|
| PubChem CID | 123310211 |
| Molecular Formula | C32H35F3N6O5S |
| Molecular Weight | 672.73 g/mol |
| Exact Mass | 672.23 |
| IUPAC Name | [(2-cyclohexa-1,5-dien-1-ylacetyl)-[5-[4-[6-[[2-[3-(trifluoromethoxy)phenyl]acetyl]amino]pyridazin-3-yl]butyl]-1,3,4-thiadiazol-2-yl]amino]methyl butanoate |
| SMILES | CCCC(=O)OCN(C(=O)CC1=CCCC=C1)c1nnc(CCCCc2ccc(NC(=O)Cc3cccc(OC(F)(F)F)c3)nn2)s1 |
| InChI | InChI=1S/C32H35F3N6O5S/c1-2-9-30(44)45-21-41(29(43)20-22-10-4-3-5-11-22)31-40-39-28(47-31)15-7-6-13-24-16-17-26(38-37-24)36-27(42)19-23-12-8-14-25(18-23)46-32(33,34)35/h4,8,10-12,14,16-18H,2-3,5-7,9,13,15,19-21H2,1H3,(H,36,38,42) |
| InChIKey | KIJVRSGSDHLPPC-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 136.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.73 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|